C28H29F2N5O3S2 — CID 118009163
(1R,2R,5S)-N-[(1R)-1-cyanoethyl]-2-[5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-2-(5-fluoro-2-pyridinyl)-1,3-thiazol-4-yl]-5-fluorocyclohexane-1-carboxamide (PubChem CID 118009163) has the molecular formula C28H29F2N5O3S2 and a molecular weight of 585.70 g/mol. Its IUPAC name is (1R,2R,5S)-N-[(1R)-1-cyanoethyl]-2-[5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-2-(5-fluoro-2-pyridinyl)-1,3-thiazol-4-yl]-5-fluorocyclohexane-1-carboxamide.
| Compound Name | (1R,2R,5S)-N-[(1R)-1-cyanoethyl]-2-[5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-2-(5-fluoro-2-pyridinyl)-1,3-thiazol-4-yl]-5-fluorocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 118009163 |
| Molecular Formula | C28H29F2N5O3S2 |
| Molecular Weight | 585.70 g/mol |
| Exact Mass | 585.17 |
| IUPAC Name | (1R,2R,5S)-N-[(1R)-1-cyanoethyl]-2-[5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-2-(5-fluoro-2-pyridinyl)-1,3-thiazol-4-yl]-5-fluorocyclohexane-1-carboxamide |
| SMILES | C[C@H](C#N)NC(=O)[C@@H]1C[C@@H](F)CC[C@H]1c1nc(-c2ccc(F)cn2)sc1-c1ccc(N2CCS(=O)(=O)CC2)cc1 |
| InChI | InChI=1S/C28H29F2N5O3S2/c1-17(15-31)33-27(36)23-14-19(29)4-8-22(23)25-26(39-28(34-25)24-9-5-20(30)16-32-24)18-2-6-21(7-3-18)35-10-12-40(37,38)13-11-35/h2-3,5-7,9,16-17,19,22-23H,4,8,10-14H2,1H3,(H,33,36)/t17-,19+,22-,23-/m1/s1 |
| InChIKey | ITVDXZKVOOYKTG-ANEJOOLBSA-N |
| XLogP | 4.50 |
| TPSA | 116.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.70 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |