C24H28N4O3S — CID 118009240
N-(cyanomethyl)-2-[2-methyl-5-[4-(morpholine-4-carbonyl)phenyl]-1,3-thiazol-4-yl]cyclohexane-1-carboxamide (PubChem CID 118009240) has the molecular formula C24H28N4O3S and a molecular weight of 452.58 g/mol. Its IUPAC name is N-(cyanomethyl)-2-[2-methyl-5-[4-(morpholine-4-carbonyl)phenyl]-1,3-thiazol-4-yl]cyclohexane-1-carboxamide.
| Compound Name | N-(cyanomethyl)-2-[2-methyl-5-[4-(morpholine-4-carbonyl)phenyl]-1,3-thiazol-4-yl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 118009240 |
| Molecular Formula | C24H28N4O3S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | N-(cyanomethyl)-2-[2-methyl-5-[4-(morpholine-4-carbonyl)phenyl]-1,3-thiazol-4-yl]cyclohexane-1-carboxamide |
| SMILES | Cc1nc(C2CCCCC2C(=O)NCC#N)c(-c2ccc(C(=O)N3CCOCC3)cc2)s1 |
| InChI | InChI=1S/C24H28N4O3S/c1-16-27-21(19-4-2-3-5-20(19)23(29)26-11-10-25)22(32-16)17-6-8-18(9-7-17)24(30)28-12-14-31-15-13-28/h6-9,19-20H,2-5,11-15H2,1H3,(H,26,29) |
| InChIKey | IIZCALAPGOUCQK-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|