C29H33N3O2 — CID 1180094
(2R)-1-(4-benzylpiperazin-1-yl)-3-[2-(4-methoxyphenyl)indol-1-yl]propan-2-ol (PubChem CID 1180094) has the molecular formula C29H33N3O2 and a molecular weight of 455.60 g/mol. Its IUPAC name is (2R)-1-(4-benzylpiperazin-1-yl)-3-[2-(4-methoxyphenyl)indol-1-yl]propan-2-ol.
| Compound Name | (2R)-1-(4-benzylpiperazin-1-yl)-3-[2-(4-methoxyphenyl)indol-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 1180094 |
| Molecular Formula | C29H33N3O2 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.26 |
| IUPAC Name | (2R)-1-(4-benzylpiperazin-1-yl)-3-[2-(4-methoxyphenyl)indol-1-yl]propan-2-ol |
| SMILES | COc1ccc(-c2cc3ccccc3n2C[C@H](O)CN2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C29H33N3O2/c1-34-27-13-11-24(12-14-27)29-19-25-9-5-6-10-28(25)32(29)22-26(33)21-31-17-15-30(16-18-31)20-23-7-3-2-4-8-23/h2-14,19,26,33H,15-18,20-22H2,1H3/t26-/m1/s1 |
| InChIKey | DWZNXBNNLICOJR-AREMUKBSSA-N |
| XLogP | 4.50 |
| TPSA | 40.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |