C17H11F3N6OS2 — CID 118009653
N-[5-[3-ethyl-1-(1,3-thiazol-2-yl)pyrazol-4-yl]-1,3,4-thiadiazol-2-yl]-2,3,6-trifluorobenzamide (PubChem CID 118009653) has the molecular formula C17H11F3N6OS2 and a molecular weight of 436.44 g/mol. Its IUPAC name is N-[5-[3-ethyl-1-(1,3-thiazol-2-yl)pyrazol-4-yl]-1,3,4-thiadiazol-2-yl]-2,3,6-trifluorobenzamide.
| Compound Name | N-[5-[3-ethyl-1-(1,3-thiazol-2-yl)pyrazol-4-yl]-1,3,4-thiadiazol-2-yl]-2,3,6-trifluorobenzamide |
|---|---|
| PubChem CID | 118009653 |
| Molecular Formula | C17H11F3N6OS2 |
| Molecular Weight | 436.44 g/mol |
| Exact Mass | 436.04 |
| IUPAC Name | N-[5-[3-ethyl-1-(1,3-thiazol-2-yl)pyrazol-4-yl]-1,3,4-thiadiazol-2-yl]-2,3,6-trifluorobenzamide |
| SMILES | CCc1nn(-c2nccs2)cc1-c1nnc(NC(=O)c2c(F)ccc(F)c2F)s1 |
| InChI | InChI=1S/C17H11F3N6OS2/c1-2-11-8(7-26(25-11)17-21-5-6-28-17)15-23-24-16(29-15)22-14(27)12-9(18)3-4-10(19)13(12)20/h3-7H,2H2,1H3,(H,22,24,27) |
| InChIKey | JNYXPGDBQWDMNU-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.44 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|