C21H14F3N5OS — CID 118009659
N-[5-[3-cyclopropyl-1-(1,3-thiazol-2-yl)pyrazol-4-yl]-2-pyridinyl]-2,3,6-trifluorobenzamide (PubChem CID 118009659) has the molecular formula C21H14F3N5OS and a molecular weight of 441.44 g/mol. Its IUPAC name is N-[5-[3-cyclopropyl-1-(1,3-thiazol-2-yl)pyrazol-4-yl]-2-pyridinyl]-2,3,6-trifluorobenzamide.
| Compound Name | N-[5-[3-cyclopropyl-1-(1,3-thiazol-2-yl)pyrazol-4-yl]-2-pyridinyl]-2,3,6-trifluorobenzamide |
|---|---|
| PubChem CID | 118009659 |
| Molecular Formula | C21H14F3N5OS |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | N-[5-[3-cyclopropyl-1-(1,3-thiazol-2-yl)pyrazol-4-yl]-2-pyridinyl]-2,3,6-trifluorobenzamide |
| SMILES | O=C(Nc1ccc(-c2cn(-c3nccs3)nc2C2CC2)cn1)c1c(F)ccc(F)c1F |
| InChI | InChI=1S/C21H14F3N5OS/c22-14-4-5-15(23)18(24)17(14)20(30)27-16-6-3-12(9-26-16)13-10-29(21-25-7-8-31-21)28-19(13)11-1-2-11/h3-11H,1-2H2,(H,26,27,30) |
| InChIKey | GCNCMUFSQNJJPA-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|