About methyl 5-oxo-4aH-benzo[c][2,6]naphthyridine-8-carboxylate
methyl 5-oxo-4aH-benzo[c][2,6]naphthyridine-8-carboxylate (PubChem CID 118009874) has the molecular formula C14H10N2O3
and a molecular weight of 254.25 g/mol. Its IUPAC name is methyl 5-oxo-4aH-benzo[c][2,6]naphthyridine-8-carboxylate.
Molecular Properties
| Compound Name | methyl 5-oxo-4aH-benzo[c][2,6]naphthyridine-8-carboxylate |
| PubChem CID | 118009874 |
| Molecular Formula | C14H10N2O3 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | methyl 5-oxo-4aH-benzo[c][2,6]naphthyridine-8-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)=NC(=O)C1C=CN=CC=21 |
| InChI | InChI=1S/C14H10N2O3/c1-19-14(18)8-2-3-9-11-7-15-5-4-10(11)13(17)16-12(9)6-8/h2-7,10H,1H3 |
| InChIKey | GQHOXGAECMTLHM-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 5-oxo-4aH-benzo[c][2,6]naphthyridine-8-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-oxo-4aH-benzo[c][2,6]naphthyridine-8-carboxylate?
The IUPAC name of methyl 5-oxo-4aH-benzo[c][2,6]naphthyridine-8-carboxylate (CID 118009874) is methyl 5-oxo-4aH-benzo[c][2,6]naphthyridine-8-carboxylate.
What is the SMILES notation for methyl 5-oxo-4aH-benzo[c][2,6]naphthyridine-8-carboxylate?
The canonical SMILES for methyl 5-oxo-4aH-benzo[c][2,6]naphthyridine-8-carboxylate is COC(=O)c1ccc2c(c1)=NC(=O)C1C=CN=CC=21.
What is the InChIKey of methyl 5-oxo-4aH-benzo[c][2,6]naphthyridine-8-carboxylate?
The InChIKey is GQHOXGAECMTLHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N2O3/c1-19-14(18)8-2-3-9-11-7-15-5-4-10(11)13(17)16-12(9)6-8/h2-7,10H,1H3.
What are the key properties of methyl 5-oxo-4aH-benzo[c][2,6]naphthyridine-8-carboxylate?
methyl 5-oxo-4aH-benzo[c][2,6]naphthyridine-8-carboxylate has a molecular weight of 254.25 g/mol, XLogP of -0.00, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-oxo-4aH-benzo[c][2,6]naphthyridine-8-carboxylate is sourced from PubChem (CID 118009874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).