About N-(3,5-dimethoxyphenyl)-7-(tetrazolidin-5-yl)thieno[3,2-c]quinolin-4-amine
N-(3,5-dimethoxyphenyl)-7-(tetrazolidin-5-yl)thieno[3,2-c]quinolin-4-amine (PubChem CID 118009879) has the molecular formula C20H20N6O2S
and a molecular weight of 408.49 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-7-(tetrazolidin-5-yl)thieno[3,2-c]quinolin-4-amine.
Molecular Properties
| Compound Name | N-(3,5-dimethoxyphenyl)-7-(tetrazolidin-5-yl)thieno[3,2-c]quinolin-4-amine |
| PubChem CID | 118009879 |
| Molecular Formula | C20H20N6O2S |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-7-(tetrazolidin-5-yl)thieno[3,2-c]quinolin-4-amine |
| SMILES | COc1cc(Nc2nc3cc(C4NNNN4)ccc3c3sccc23)cc(OC)c1 |
| InChI | InChI=1S/C20H20N6O2S/c1-27-13-8-12(9-14(10-13)28-2)21-20-16-5-6-29-18(16)15-4-3-11(7-17(15)22-20)19-23-25-26-24-19/h3-10,19,23-26H,1-2H3,(H,21,22) |
| InChIKey | MBRVLHLEXMQIMD-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze N-(3,5-dimethoxyphenyl)-7-(tetrazolidin-5-yl)thieno[3,2-c]quinolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,5-dimethoxyphenyl)-7-(tetrazolidin-5-yl)thieno[3,2-c]quinolin-4-amine?
The IUPAC name of N-(3,5-dimethoxyphenyl)-7-(tetrazolidin-5-yl)thieno[3,2-c]quinolin-4-amine (CID 118009879) is N-(3,5-dimethoxyphenyl)-7-(tetrazolidin-5-yl)thieno[3,2-c]quinolin-4-amine.
What is the SMILES notation for N-(3,5-dimethoxyphenyl)-7-(tetrazolidin-5-yl)thieno[3,2-c]quinolin-4-amine?
The canonical SMILES for N-(3,5-dimethoxyphenyl)-7-(tetrazolidin-5-yl)thieno[3,2-c]quinolin-4-amine is COc1cc(Nc2nc3cc(C4NNNN4)ccc3c3sccc23)cc(OC)c1.
What is the InChIKey of N-(3,5-dimethoxyphenyl)-7-(tetrazolidin-5-yl)thieno[3,2-c]quinolin-4-amine?
The InChIKey is MBRVLHLEXMQIMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N6O2S/c1-27-13-8-12(9-14(10-13)28-2)21-20-16-5-6-29-18(16)15-4-3-11(7-17(15)22-20)19-23-25-26-24-19/h3-10,19,23-26H,1-2H3,(H,21,22).
What are the key properties of N-(3,5-dimethoxyphenyl)-7-(tetrazolidin-5-yl)thieno[3,2-c]quinolin-4-amine?
N-(3,5-dimethoxyphenyl)-7-(tetrazolidin-5-yl)thieno[3,2-c]quinolin-4-amine has a molecular weight of 408.49 g/mol, XLogP of 3.33, 5 rotatable bonds, 5 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,5-dimethoxyphenyl)-7-(tetrazolidin-5-yl)thieno[3,2-c]quinolin-4-amine is sourced from PubChem (CID 118009879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).