About N-(3-fluorophenyl)-7-(tetrazolidin-5-yl)thieno[3,2-c]quinolin-4-amine
N-(3-fluorophenyl)-7-(tetrazolidin-5-yl)thieno[3,2-c]quinolin-4-amine (PubChem CID 118009887) has the molecular formula C18H15FN6S
and a molecular weight of 366.43 g/mol. Its IUPAC name is N-(3-fluorophenyl)-7-(tetrazolidin-5-yl)thieno[3,2-c]quinolin-4-amine.
Molecular Properties
| Compound Name | N-(3-fluorophenyl)-7-(tetrazolidin-5-yl)thieno[3,2-c]quinolin-4-amine |
| PubChem CID | 118009887 |
| Molecular Formula | C18H15FN6S |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | N-(3-fluorophenyl)-7-(tetrazolidin-5-yl)thieno[3,2-c]quinolin-4-amine |
| SMILES | Fc1cccc(Nc2nc3cc(C4NNNN4)ccc3c3sccc23)c1 |
| InChI | InChI=1S/C18H15FN6S/c19-11-2-1-3-12(9-11)20-18-14-6-7-26-16(14)13-5-4-10(8-15(13)21-18)17-22-24-25-23-17/h1-9,17,22-25H,(H,20,21) |
| InChIKey | NIGSCDHTNGFATO-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 73.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-(3-fluorophenyl)-7-(tetrazolidin-5-yl)thieno[3,2-c]quinolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-fluorophenyl)-7-(tetrazolidin-5-yl)thieno[3,2-c]quinolin-4-amine?
The IUPAC name of N-(3-fluorophenyl)-7-(tetrazolidin-5-yl)thieno[3,2-c]quinolin-4-amine (CID 118009887) is N-(3-fluorophenyl)-7-(tetrazolidin-5-yl)thieno[3,2-c]quinolin-4-amine.
What is the SMILES notation for N-(3-fluorophenyl)-7-(tetrazolidin-5-yl)thieno[3,2-c]quinolin-4-amine?
The canonical SMILES for N-(3-fluorophenyl)-7-(tetrazolidin-5-yl)thieno[3,2-c]quinolin-4-amine is Fc1cccc(Nc2nc3cc(C4NNNN4)ccc3c3sccc23)c1.
What is the InChIKey of N-(3-fluorophenyl)-7-(tetrazolidin-5-yl)thieno[3,2-c]quinolin-4-amine?
The InChIKey is NIGSCDHTNGFATO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15FN6S/c19-11-2-1-3-12(9-11)20-18-14-6-7-26-16(14)13-5-4-10(8-15(13)21-18)17-22-24-25-23-17/h1-9,17,22-25H,(H,20,21).
What are the key properties of N-(3-fluorophenyl)-7-(tetrazolidin-5-yl)thieno[3,2-c]quinolin-4-amine?
N-(3-fluorophenyl)-7-(tetrazolidin-5-yl)thieno[3,2-c]quinolin-4-amine has a molecular weight of 366.43 g/mol, XLogP of 3.45, 3 rotatable bonds, 5 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-fluorophenyl)-7-(tetrazolidin-5-yl)thieno[3,2-c]quinolin-4-amine is sourced from PubChem (CID 118009887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).