About 4-(2-chloro-4,5-dimethylphenoxy)-3-cyano-N-(5-fluoro-2-pyridinyl)benzenesulfonamide
4-(2-chloro-4,5-dimethylphenoxy)-3-cyano-N-(5-fluoro-2-pyridinyl)benzenesulfonamide (PubChem CID 118009968) has the molecular formula C20H15ClFN3O3S
and a molecular weight of 431.88 g/mol. Its IUPAC name is 4-(2-chloro-4,5-dimethylphenoxy)-3-cyano-N-(5-fluoro-2-pyridinyl)benzenesulfonamide.
Molecular Properties
| Compound Name | 4-(2-chloro-4,5-dimethylphenoxy)-3-cyano-N-(5-fluoro-2-pyridinyl)benzenesulfonamide |
| PubChem CID | 118009968 |
| Molecular Formula | C20H15ClFN3O3S |
| Molecular Weight | 431.88 g/mol |
| Exact Mass | 431.05 |
| IUPAC Name | 4-(2-chloro-4,5-dimethylphenoxy)-3-cyano-N-(5-fluoro-2-pyridinyl)benzenesulfonamide |
| SMILES | Cc1cc(Cl)c(Oc2ccc(S(=O)(=O)Nc3ccc(F)cn3)cc2C#N)cc1C |
| InChI | InChI=1S/C20H15ClFN3O3S/c1-12-7-17(21)19(8-13(12)2)28-18-5-4-16(9-14(18)10-23)29(26,27)25-20-6-3-15(22)11-24-20/h3-9,11H,1-2H3,(H,24,25) |
| InChIKey | NQKDGVPKOSWPLR-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.88 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(2-chloro-4,5-dimethylphenoxy)-3-cyano-N-(5-fluoro-2-pyridinyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-chloro-4,5-dimethylphenoxy)-3-cyano-N-(5-fluoro-2-pyridinyl)benzenesulfonamide?
The IUPAC name of 4-(2-chloro-4,5-dimethylphenoxy)-3-cyano-N-(5-fluoro-2-pyridinyl)benzenesulfonamide (CID 118009968) is 4-(2-chloro-4,5-dimethylphenoxy)-3-cyano-N-(5-fluoro-2-pyridinyl)benzenesulfonamide.
What is the SMILES notation for 4-(2-chloro-4,5-dimethylphenoxy)-3-cyano-N-(5-fluoro-2-pyridinyl)benzenesulfonamide?
The canonical SMILES for 4-(2-chloro-4,5-dimethylphenoxy)-3-cyano-N-(5-fluoro-2-pyridinyl)benzenesulfonamide is Cc1cc(Cl)c(Oc2ccc(S(=O)(=O)Nc3ccc(F)cn3)cc2C#N)cc1C.
What is the InChIKey of 4-(2-chloro-4,5-dimethylphenoxy)-3-cyano-N-(5-fluoro-2-pyridinyl)benzenesulfonamide?
The InChIKey is NQKDGVPKOSWPLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15ClFN3O3S/c1-12-7-17(21)19(8-13(12)2)28-18-5-4-16(9-14(18)10-23)29(26,27)25-20-6-3-15(22)11-24-20/h3-9,11H,1-2H3,(H,24,25).
What are the key properties of 4-(2-chloro-4,5-dimethylphenoxy)-3-cyano-N-(5-fluoro-2-pyridinyl)benzenesulfonamide?
4-(2-chloro-4,5-dimethylphenoxy)-3-cyano-N-(5-fluoro-2-pyridinyl)benzenesulfonamide has a molecular weight of 431.88 g/mol, XLogP of 4.96, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-chloro-4,5-dimethylphenoxy)-3-cyano-N-(5-fluoro-2-pyridinyl)benzenesulfonamide is sourced from PubChem (CID 118009968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).