C20H14F3N5OS — CID 118010169
2,3,6-trifluoro-N-[5-[3-methyl-1-(5-methyl-1,3-thiazol-2-yl)pyrazol-4-yl]-2-pyridinyl]benzamide (PubChem CID 118010169) has the molecular formula C20H14F3N5OS and a molecular weight of 429.43 g/mol. Its IUPAC name is 2,3,6-trifluoro-N-[5-[3-methyl-1-(5-methyl-1,3-thiazol-2-yl)pyrazol-4-yl]-2-pyridinyl]benzamide.
| Compound Name | 2,3,6-trifluoro-N-[5-[3-methyl-1-(5-methyl-1,3-thiazol-2-yl)pyrazol-4-yl]-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 118010169 |
| Molecular Formula | C20H14F3N5OS |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | 2,3,6-trifluoro-N-[5-[3-methyl-1-(5-methyl-1,3-thiazol-2-yl)pyrazol-4-yl]-2-pyridinyl]benzamide |
| SMILES | Cc1cnc(-n2cc(-c3ccc(NC(=O)c4c(F)ccc(F)c4F)nc3)c(C)n2)s1 |
| InChI | InChI=1S/C20H14F3N5OS/c1-10-7-25-20(30-10)28-9-13(11(2)27-28)12-3-6-16(24-8-12)26-19(29)17-14(21)4-5-15(22)18(17)23/h3-9H,1-2H3,(H,24,26,29) |
| InChIKey | WQKJZQJBUPQVCR-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|