About 7-(chloromethyl)-3-cyclohexyl-2-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one
7-(chloromethyl)-3-cyclohexyl-2-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one (PubChem CID 118010450) has the molecular formula C14H17ClN2OS
and a molecular weight of 296.82 g/mol. Its IUPAC name is 7-(chloromethyl)-3-cyclohexyl-2-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one.
Molecular Properties
| Compound Name | 7-(chloromethyl)-3-cyclohexyl-2-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
| PubChem CID | 118010450 |
| Molecular Formula | C14H17ClN2OS |
| Molecular Weight | 296.82 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 7-(chloromethyl)-3-cyclohexyl-2-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
| SMILES | Cc1sc2nc(CCl)cc(=O)n2c1C1CCCCC1 |
| InChI | InChI=1S/C14H17ClN2OS/c1-9-13(10-5-3-2-4-6-10)17-12(18)7-11(8-15)16-14(17)19-9/h7,10H,2-6,8H2,1H3 |
| InChIKey | ZMGXNWVUEQTCSY-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.82 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 7-(chloromethyl)-3-cyclohexyl-2-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(chloromethyl)-3-cyclohexyl-2-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one?
The IUPAC name of 7-(chloromethyl)-3-cyclohexyl-2-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one (CID 118010450) is 7-(chloromethyl)-3-cyclohexyl-2-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one.
What is the SMILES notation for 7-(chloromethyl)-3-cyclohexyl-2-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one?
The canonical SMILES for 7-(chloromethyl)-3-cyclohexyl-2-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one is Cc1sc2nc(CCl)cc(=O)n2c1C1CCCCC1.
What is the InChIKey of 7-(chloromethyl)-3-cyclohexyl-2-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one?
The InChIKey is ZMGXNWVUEQTCSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17ClN2OS/c1-9-13(10-5-3-2-4-6-10)17-12(18)7-11(8-15)16-14(17)19-9/h7,10H,2-6,8H2,1H3.
What are the key properties of 7-(chloromethyl)-3-cyclohexyl-2-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one?
7-(chloromethyl)-3-cyclohexyl-2-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one has a molecular weight of 296.82 g/mol, XLogP of 3.85, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(chloromethyl)-3-cyclohexyl-2-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one is sourced from PubChem (CID 118010450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).