C11H15NO4S — CID 118010498
2-[2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethyl(dimethyl)azaniumyl]acetate (PubChem CID 118010498) has the molecular formula C11H15NO4S and a molecular weight of 257.31 g/mol. Its IUPAC name is 2-[2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethyl(dimethyl)azaniumyl]acetate.
| Compound Name | 2-[2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethyl(dimethyl)azaniumyl]acetate |
|---|---|
| PubChem CID | 118010498 |
| Molecular Formula | C11H15NO4S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 2-[2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethyl(dimethyl)azaniumyl]acetate |
| SMILES | C[N+](C)(CC(=O)[O-])CC1COc2cscc2O1 |
| InChI | InChI=1S/C11H15NO4S/c1-12(2,4-11(13)14)3-8-5-15-9-6-17-7-10(9)16-8/h6-8H,3-5H2,1-2H3 |
| InChIKey | IKWAUVITIOTFQB-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|