C20H17FN4O2 — CID 118010665
tert-butyl 11-(6-fluoro-3-pyridinyl)-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-8-carboxylate (PubChem CID 118010665) has the molecular formula C20H17FN4O2 and a molecular weight of 364.38 g/mol. Its IUPAC name is tert-butyl 11-(6-fluoro-3-pyridinyl)-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-8-carboxylate.
| Compound Name | tert-butyl 11-(6-fluoro-3-pyridinyl)-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-8-carboxylate |
|---|---|
| PubChem CID | 118010665 |
| Molecular Formula | C20H17FN4O2 |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | tert-butyl 11-(6-fluoro-3-pyridinyl)-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1c2ccncc2c2ccc(-c3ccc(F)nc3)nc21 |
| InChI | InChI=1S/C20H17FN4O2/c1-20(2,3)27-19(26)25-16-8-9-22-11-14(16)13-5-6-15(24-18(13)25)12-4-7-17(21)23-10-12/h4-11H,1-3H3 |
| InChIKey | DUPWDSCDGKLDQI-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|