About (NE)-N-[(2R,4S)-4-(methoxymethoxy)-2-phenylmethoxyhex-5-enylidene]hydroxylamine
(NE)-N-[(2R,4S)-4-(methoxymethoxy)-2-phenylmethoxyhex-5-enylidene]hydroxylamine (PubChem CID 118010666) has the molecular formula C15H21NO4
and a molecular weight of 279.34 g/mol. Its IUPAC name is (NE)-N-[(2R,4S)-4-(methoxymethoxy)-2-phenylmethoxyhex-5-enylidene]hydroxylamine.
Molecular Properties
| Compound Name | (NE)-N-[(2R,4S)-4-(methoxymethoxy)-2-phenylmethoxyhex-5-enylidene]hydroxylamine |
| PubChem CID | 118010666 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | (NE)-N-[(2R,4S)-4-(methoxymethoxy)-2-phenylmethoxyhex-5-enylidene]hydroxylamine |
| SMILES | C=C[C@H](C[C@H](/C=N/O)OCc1ccccc1)OCOC |
| InChI | InChI=1S/C15H21NO4/c1-3-14(20-12-18-2)9-15(10-16-17)19-11-13-7-5-4-6-8-13/h3-8,10,14-15,17H,1,9,11-12H2,2H3/b16-10+/t14-,15-/m1/s1 |
| InChIKey | HSTFOZCBYGKFOF-BAQSSVPWSA-N |
| XLogP | 2.60 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (NE)-N-[(2R,4S)-4-(methoxymethoxy)-2-phenylmethoxyhex-5-enylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NE)-N-[(2R,4S)-4-(methoxymethoxy)-2-phenylmethoxyhex-5-enylidene]hydroxylamine?
The IUPAC name of (NE)-N-[(2R,4S)-4-(methoxymethoxy)-2-phenylmethoxyhex-5-enylidene]hydroxylamine (CID 118010666) is (NE)-N-[(2R,4S)-4-(methoxymethoxy)-2-phenylmethoxyhex-5-enylidene]hydroxylamine.
What is the SMILES notation for (NE)-N-[(2R,4S)-4-(methoxymethoxy)-2-phenylmethoxyhex-5-enylidene]hydroxylamine?
The canonical SMILES for (NE)-N-[(2R,4S)-4-(methoxymethoxy)-2-phenylmethoxyhex-5-enylidene]hydroxylamine is C=C[C@H](C[C@H](/C=N/O)OCc1ccccc1)OCOC.
What is the InChIKey of (NE)-N-[(2R,4S)-4-(methoxymethoxy)-2-phenylmethoxyhex-5-enylidene]hydroxylamine?
The InChIKey is HSTFOZCBYGKFOF-BAQSSVPWSA-N. The full InChI is InChI=1S/C15H21NO4/c1-3-14(20-12-18-2)9-15(10-16-17)19-11-13-7-5-4-6-8-13/h3-8,10,14-15,17H,1,9,11-12H2,2H3/b16-10+/t14-,15-/m1/s1.
What are the key properties of (NE)-N-[(2R,4S)-4-(methoxymethoxy)-2-phenylmethoxyhex-5-enylidene]hydroxylamine?
(NE)-N-[(2R,4S)-4-(methoxymethoxy)-2-phenylmethoxyhex-5-enylidene]hydroxylamine has a molecular weight of 279.34 g/mol, XLogP of 2.60, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (NE)-N-[(2R,4S)-4-(methoxymethoxy)-2-phenylmethoxyhex-5-enylidene]hydroxylamine is sourced from PubChem (CID 118010666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).