About N-[2-(5-methoxy-1,3-dihydroisoindol-2-yl)-6-methylpyrimidin-4-yl]-1H-indazol-5-amine
N-[2-(5-methoxy-1,3-dihydroisoindol-2-yl)-6-methylpyrimidin-4-yl]-1H-indazol-5-amine (PubChem CID 118010949) has the molecular formula C21H20N6O
and a molecular weight of 372.43 g/mol. Its IUPAC name is N-[2-(5-methoxy-1,3-dihydroisoindol-2-yl)-6-methylpyrimidin-4-yl]-1H-indazol-5-amine.
Molecular Properties
| Compound Name | N-[2-(5-methoxy-1,3-dihydroisoindol-2-yl)-6-methylpyrimidin-4-yl]-1H-indazol-5-amine |
| PubChem CID | 118010949 |
| Molecular Formula | C21H20N6O |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | N-[2-(5-methoxy-1,3-dihydroisoindol-2-yl)-6-methylpyrimidin-4-yl]-1H-indazol-5-amine |
| SMILES | COc1ccc2c(c1)CN(c1nc(C)cc(Nc3ccc4[nH]ncc4c3)n1)C2 |
| InChI | InChI=1S/C21H20N6O/c1-13-7-20(24-17-4-6-19-15(8-17)10-22-26-19)25-21(23-13)27-11-14-3-5-18(28-2)9-16(14)12-27/h3-10H,11-12H2,1-2H3,(H,22,26)(H,23,24,25) |
| InChIKey | LORUKWDAVJYKND-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[2-(5-methoxy-1,3-dihydroisoindol-2-yl)-6-methylpyrimidin-4-yl]-1H-indazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(5-methoxy-1,3-dihydroisoindol-2-yl)-6-methylpyrimidin-4-yl]-1H-indazol-5-amine?
The IUPAC name of N-[2-(5-methoxy-1,3-dihydroisoindol-2-yl)-6-methylpyrimidin-4-yl]-1H-indazol-5-amine (CID 118010949) is N-[2-(5-methoxy-1,3-dihydroisoindol-2-yl)-6-methylpyrimidin-4-yl]-1H-indazol-5-amine.
What is the SMILES notation for N-[2-(5-methoxy-1,3-dihydroisoindol-2-yl)-6-methylpyrimidin-4-yl]-1H-indazol-5-amine?
The canonical SMILES for N-[2-(5-methoxy-1,3-dihydroisoindol-2-yl)-6-methylpyrimidin-4-yl]-1H-indazol-5-amine is COc1ccc2c(c1)CN(c1nc(C)cc(Nc3ccc4[nH]ncc4c3)n1)C2.
What is the InChIKey of N-[2-(5-methoxy-1,3-dihydroisoindol-2-yl)-6-methylpyrimidin-4-yl]-1H-indazol-5-amine?
The InChIKey is LORUKWDAVJYKND-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N6O/c1-13-7-20(24-17-4-6-19-15(8-17)10-22-26-19)25-21(23-13)27-11-14-3-5-18(28-2)9-16(14)12-27/h3-10H,11-12H2,1-2H3,(H,22,26)(H,23,24,25).
What are the key properties of N-[2-(5-methoxy-1,3-dihydroisoindol-2-yl)-6-methylpyrimidin-4-yl]-1H-indazol-5-amine?
N-[2-(5-methoxy-1,3-dihydroisoindol-2-yl)-6-methylpyrimidin-4-yl]-1H-indazol-5-amine has a molecular weight of 372.43 g/mol, XLogP of 3.93, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(5-methoxy-1,3-dihydroisoindol-2-yl)-6-methylpyrimidin-4-yl]-1H-indazol-5-amine is sourced from PubChem (CID 118010949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).