About N-phenyltetrazin-5-amine
N-phenyltetrazin-5-amine (PubChem CID 118011274) has the molecular formula C8H7N5
and a molecular weight of 173.18 g/mol. Its IUPAC name is N-phenyltetrazin-5-amine.
Molecular Properties
| Compound Name | N-phenyltetrazin-5-amine |
| PubChem CID | 118011274 |
| Molecular Formula | C8H7N5 |
| Molecular Weight | 173.18 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | N-phenyltetrazin-5-amine |
| SMILES | c1ccc(Nc2cnnnn2)cc1 |
| InChI | InChI=1S/C8H7N5/c1-2-4-7(5-3-1)10-8-6-9-12-13-11-8/h1-6H,(H,10,11,12) |
| InChIKey | XURPVLSGRKLXEB-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.18 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-phenyltetrazin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenyltetrazin-5-amine?
The IUPAC name of N-phenyltetrazin-5-amine (CID 118011274) is N-phenyltetrazin-5-amine.
What is the SMILES notation for N-phenyltetrazin-5-amine?
The canonical SMILES for N-phenyltetrazin-5-amine is c1ccc(Nc2cnnnn2)cc1.
What is the InChIKey of N-phenyltetrazin-5-amine?
The InChIKey is XURPVLSGRKLXEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N5/c1-2-4-7(5-3-1)10-8-6-9-12-13-11-8/h1-6H,(H,10,11,12).
What are the key properties of N-phenyltetrazin-5-amine?
N-phenyltetrazin-5-amine has a molecular weight of 173.18 g/mol, XLogP of 1.01, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenyltetrazin-5-amine is sourced from PubChem (CID 118011274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).