C34H34N2OP+ — CID 118011322
2-[[2-[methyl-(6-methylnaphthalen-2-yl)amino]acetyl]amino]ethyl-triphenylphosphanium (PubChem CID 118011322) has the molecular formula C34H34N2OP+ and a molecular weight of 517.63 g/mol. Its IUPAC name is 2-[[2-[methyl-(6-methylnaphthalen-2-yl)amino]acetyl]amino]ethyl-triphenylphosphanium.
| Compound Name | 2-[[2-[methyl-(6-methylnaphthalen-2-yl)amino]acetyl]amino]ethyl-triphenylphosphanium |
|---|---|
| PubChem CID | 118011322 |
| Molecular Formula | C34H34N2OP+ |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.24 |
| IUPAC Name | 2-[[2-[methyl-(6-methylnaphthalen-2-yl)amino]acetyl]amino]ethyl-triphenylphosphanium |
| SMILES | Cc1ccc2cc(N(C)CC(=O)NCC[P+](c3ccccc3)(c3ccccc3)c3ccccc3)ccc2c1 |
| InChI | InChI=1S/C34H33N2OP/c1-27-18-19-29-25-30(21-20-28(29)24-27)36(2)26-34(37)35-22-23-38(31-12-6-3-7-13-31,32-14-8-4-9-15-32)33-16-10-5-11-17-33/h3-21,24-25H,22-23,26H2,1-2H3/p+1 |
| InChIKey | NFEYSQPCFMAZFD-UHFFFAOYSA-O |
| XLogP | 5.69 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|