C20H20F6O8S3 — CID 118011328
1,1,2,2,3,3-hexafluoro-3-[4-[2-(2-methylbutanoyloxy)ethylsulfanyl]naphthalen-1-yl]oxysulfonylpropane-1-sulfonic acid (PubChem CID 118011328) has the molecular formula C20H20F6O8S3 and a molecular weight of 598.56 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-3-[4-[2-(2-methylbutanoyloxy)ethylsulfanyl]naphthalen-1-yl]oxysulfonylpropane-1-sulfonic acid.
| Compound Name | 1,1,2,2,3,3-hexafluoro-3-[4-[2-(2-methylbutanoyloxy)ethylsulfanyl]naphthalen-1-yl]oxysulfonylpropane-1-sulfonic acid |
|---|---|
| PubChem CID | 118011328 |
| Molecular Formula | C20H20F6O8S3 |
| Molecular Weight | 598.56 g/mol |
| Exact Mass | 598.02 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-3-[4-[2-(2-methylbutanoyloxy)ethylsulfanyl]naphthalen-1-yl]oxysulfonylpropane-1-sulfonic acid |
| SMILES | CCC(C)C(=O)OCCSc1ccc(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O)c2ccccc12 |
| InChI | InChI=1S/C20H20F6O8S3/c1-3-12(2)17(27)33-10-11-35-16-9-8-15(13-6-4-5-7-14(13)16)34-37(31,32)20(25,26)18(21,22)19(23,24)36(28,29)30/h4-9,12H,3,10-11H2,1-2H3,(H,28,29,30) |
| InChIKey | XLUQOBNTELYMTJ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.56 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|