C32H51N3O10 — CID 118011473
4-[10-[[(1S)-4-[2-[2-[2-(butylamino)-2-oxoethoxy]ethoxy]ethylamino]-1-carboxy-4-oxobutyl]amino]-10-oxodecoxy]benzoic acid (PubChem CID 118011473) has the molecular formula C32H51N3O10 and a molecular weight of 637.77 g/mol. Its IUPAC name is 4-[10-[[(1S)-4-[2-[2-[2-(butylamino)-2-oxoethoxy]ethoxy]ethylamino]-1-carboxy-4-oxobutyl]amino]-10-oxodecoxy]benzoic acid.
| Compound Name | 4-[10-[[(1S)-4-[2-[2-[2-(butylamino)-2-oxoethoxy]ethoxy]ethylamino]-1-carboxy-4-oxobutyl]amino]-10-oxodecoxy]benzoic acid |
|---|---|
| PubChem CID | 118011473 |
| Molecular Formula | C32H51N3O10 |
| Molecular Weight | 637.77 g/mol |
| Exact Mass | 637.36 |
| IUPAC Name | 4-[10-[[(1S)-4-[2-[2-[2-(butylamino)-2-oxoethoxy]ethoxy]ethylamino]-1-carboxy-4-oxobutyl]amino]-10-oxodecoxy]benzoic acid |
| SMILES | CCCCNC(=O)COCCOCCNC(=O)CC[C@H](NC(=O)CCCCCCCCCOc1ccc(C(=O)O)cc1)C(=O)O |
| InChI | InChI=1S/C32H51N3O10/c1-2-3-18-33-30(38)24-44-23-22-43-21-19-34-28(36)17-16-27(32(41)42)35-29(37)11-9-7-5-4-6-8-10-20-45-26-14-12-25(13-15-26)31(39)40/h12-15,27H,2-11,16-24H2,1H3,(H,33,38)(H,34,36)(H,35,37)(H,39,40)(H,41,42)/t27-/m0/s1 |
| InChIKey | SMVSLEMWOJWEBL-MHZLTWQESA-N |
| XLogP | 3.30 |
| TPSA | 189.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.77 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|