C24H29N3O — CID 118011538
2,8-dimethyl-5-(2-prop-1-en-2-yloxy-2-pyridin-3-ylpropyl)-3,4-dihydro-1H-pyrido[4,3-b]indole (PubChem CID 118011538) has the molecular formula C24H29N3O and a molecular weight of 375.52 g/mol. Its IUPAC name is 2,8-dimethyl-5-(2-prop-1-en-2-yloxy-2-pyridin-3-ylpropyl)-3,4-dihydro-1H-pyrido[4,3-b]indole.
| Compound Name | 2,8-dimethyl-5-(2-prop-1-en-2-yloxy-2-pyridin-3-ylpropyl)-3,4-dihydro-1H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 118011538 |
| Molecular Formula | C24H29N3O |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | 2,8-dimethyl-5-(2-prop-1-en-2-yloxy-2-pyridin-3-ylpropyl)-3,4-dihydro-1H-pyrido[4,3-b]indole |
| SMILES | C=C(C)OC(C)(Cn1c2c(c3cc(C)ccc31)CN(C)CC2)c1cccnc1 |
| InChI | InChI=1S/C24H29N3O/c1-17(2)28-24(4,19-7-6-11-25-14-19)16-27-22-9-8-18(3)13-20(22)21-15-26(5)12-10-23(21)27/h6-9,11,13-14H,1,10,12,15-16H2,2-5H3 |
| InChIKey | VKVSCNGNPBNHSO-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|