C19H19ClN2O — CID 118011547
2-(6-chloro-1,2,3,4-tetrahydrocarbazol-9-yl)-1-pyridin-4-ylethanol (PubChem CID 118011547) has the molecular formula C19H19ClN2O and a molecular weight of 326.83 g/mol. Its IUPAC name is 2-(6-chloro-1,2,3,4-tetrahydrocarbazol-9-yl)-1-pyridin-4-ylethanol.
| Compound Name | 2-(6-chloro-1,2,3,4-tetrahydrocarbazol-9-yl)-1-pyridin-4-ylethanol |
|---|---|
| PubChem CID | 118011547 |
| Molecular Formula | C19H19ClN2O |
| Molecular Weight | 326.83 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 2-(6-chloro-1,2,3,4-tetrahydrocarbazol-9-yl)-1-pyridin-4-ylethanol |
| SMILES | OC(Cn1c2c(c3cc(Cl)ccc31)CCCC2)c1ccncc1 |
| InChI | InChI=1S/C19H19ClN2O/c20-14-5-6-18-16(11-14)15-3-1-2-4-17(15)22(18)12-19(23)13-7-9-21-10-8-13/h5-11,19,23H,1-4,12H2 |
| InChIKey | BWWWHCLBPKNZOI-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.83 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|