C19H23N5O — CID 118011588
1-(1H-imidazol-2-yl)-2-(14-methyl-6,10,12-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11(16),12,14-tetraen-10-yl)ethanol (PubChem CID 118011588) has the molecular formula C19H23N5O and a molecular weight of 337.43 g/mol. Its IUPAC name is 1-(1H-imidazol-2-yl)-2-(14-methyl-6,10,12-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11(16),12,14-tetraen-10-yl)ethanol.
| Compound Name | 1-(1H-imidazol-2-yl)-2-(14-methyl-6,10,12-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11(16),12,14-tetraen-10-yl)ethanol |
|---|---|
| PubChem CID | 118011588 |
| Molecular Formula | C19H23N5O |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | 1-(1H-imidazol-2-yl)-2-(14-methyl-6,10,12-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11(16),12,14-tetraen-10-yl)ethanol |
| SMILES | Cc1cnc2c(c1)c1c(n2CC(O)c2ncc[nH]2)CCN2CCCC12 |
| InChI | InChI=1S/C19H23N5O/c1-12-9-13-17-14-3-2-7-23(14)8-4-15(17)24(19(13)22-10-12)11-16(25)18-20-5-6-21-18/h5-6,9-10,14,16,25H,2-4,7-8,11H2,1H3,(H,20,21) |
| InChIKey | CYGCCROFVMGBRP-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |