C18H22N6O — CID 118011590
2-(14-methyl-6,10,12-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11(16),12,14-tetraen-10-yl)-1-(2H-triazol-4-yl)ethanol (PubChem CID 118011590) has the molecular formula C18H22N6O and a molecular weight of 338.41 g/mol. Its IUPAC name is 2-(14-methyl-6,10,12-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11(16),12,14-tetraen-10-yl)-1-(2H-triazol-4-yl)ethanol.
| Compound Name | 2-(14-methyl-6,10,12-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11(16),12,14-tetraen-10-yl)-1-(2H-triazol-4-yl)ethanol |
|---|---|
| PubChem CID | 118011590 |
| Molecular Formula | C18H22N6O |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | 2-(14-methyl-6,10,12-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11(16),12,14-tetraen-10-yl)-1-(2H-triazol-4-yl)ethanol |
| SMILES | Cc1cnc2c(c1)c1c(n2CC(O)c2cn[nH]n2)CCN2CCCC12 |
| InChI | InChI=1S/C18H22N6O/c1-11-7-12-17-14-3-2-5-23(14)6-4-15(17)24(18(12)19-8-11)10-16(25)13-9-20-22-21-13/h7-9,14,16,25H,2-6,10H2,1H3,(H,20,21,22) |
| InChIKey | VTFRIXLEQHALFX-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |