C11H16N2 — CID 118011663
2,3,5-trimethyl-1,2,3,4-tetrahydroquinoxaline (PubChem CID 118011663) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 2,3,5-trimethyl-1,2,3,4-tetrahydroquinoxaline.
| Compound Name | 2,3,5-trimethyl-1,2,3,4-tetrahydroquinoxaline |
|---|---|
| PubChem CID | 118011663 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 2,3,5-trimethyl-1,2,3,4-tetrahydroquinoxaline |
| SMILES | Cc1cccc2c1NC(C)C(C)N2 |
| InChI | InChI=1S/C11H16N2/c1-7-5-4-6-10-11(7)13-9(3)8(2)12-10/h4-6,8-9,12-13H,1-3H3 |
| InChIKey | XOSYMRBFVWBQTA-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |