C18H26ClIO3 — CID 118012078
tert-butyl (2E,4E)-2-(3-chloropropyl)-4-[(Z)-3-iodoprop-1-enyl]-6-methoxyhepta-2,4,6-trienoate (PubChem CID 118012078) has the molecular formula C18H26ClIO3 and a molecular weight of 452.76 g/mol. Its IUPAC name is tert-butyl (2E,4E)-2-(3-chloropropyl)-4-[(Z)-3-iodoprop-1-enyl]-6-methoxyhepta-2,4,6-trienoate.
| Compound Name | tert-butyl (2E,4E)-2-(3-chloropropyl)-4-[(Z)-3-iodoprop-1-enyl]-6-methoxyhepta-2,4,6-trienoate |
|---|---|
| PubChem CID | 118012078 |
| Molecular Formula | C18H26ClIO3 |
| Molecular Weight | 452.76 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | tert-butyl (2E,4E)-2-(3-chloropropyl)-4-[(Z)-3-iodoprop-1-enyl]-6-methoxyhepta-2,4,6-trienoate |
| SMILES | C=C(/C=C(\C=C/CI)/C=C(\CCCCl)C(=O)OC(C)(C)C)OC |
| InChI | InChI=1S/C18H26ClIO3/c1-14(22-5)12-15(8-7-11-20)13-16(9-6-10-19)17(21)23-18(2,3)4/h7-8,12-13H,1,6,9-11H2,2-5H3/b8-7-,15-12+,16-13+ |
| InChIKey | MTSAMAHNPFJSCF-WKNAMRQGSA-N |
| XLogP | 5.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.76 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|