About 5-tert-butyl-1H-pyrazolo[3,4-b]pyrazine
5-tert-butyl-1H-pyrazolo[3,4-b]pyrazine (PubChem CID 118012662) has the molecular formula C9H12N4
and a molecular weight of 176.22 g/mol. Its IUPAC name is 5-tert-butyl-1H-pyrazolo[3,4-b]pyrazine.
Molecular Properties
| Compound Name | 5-tert-butyl-1H-pyrazolo[3,4-b]pyrazine |
| PubChem CID | 118012662 |
| Molecular Formula | C9H12N4 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | 5-tert-butyl-1H-pyrazolo[3,4-b]pyrazine |
| SMILES | CC(C)(C)c1cnc2[nH]ncc2n1 |
| InChI | InChI=1S/C9H12N4/c1-9(2,3)7-5-10-8-6(12-7)4-11-13-8/h4-5H,1-3H3,(H,10,11,13) |
| InChIKey | BOTJBQFIENTLKA-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-tert-butyl-1H-pyrazolo[3,4-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-1H-pyrazolo[3,4-b]pyrazine?
The IUPAC name of 5-tert-butyl-1H-pyrazolo[3,4-b]pyrazine (CID 118012662) is 5-tert-butyl-1H-pyrazolo[3,4-b]pyrazine.
What is the SMILES notation for 5-tert-butyl-1H-pyrazolo[3,4-b]pyrazine?
The canonical SMILES for 5-tert-butyl-1H-pyrazolo[3,4-b]pyrazine is CC(C)(C)c1cnc2[nH]ncc2n1.
What is the InChIKey of 5-tert-butyl-1H-pyrazolo[3,4-b]pyrazine?
The InChIKey is BOTJBQFIENTLKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4/c1-9(2,3)7-5-10-8-6(12-7)4-11-13-8/h4-5H,1-3H3,(H,10,11,13).
What are the key properties of 5-tert-butyl-1H-pyrazolo[3,4-b]pyrazine?
5-tert-butyl-1H-pyrazolo[3,4-b]pyrazine has a molecular weight of 176.22 g/mol, XLogP of 1.65, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-1H-pyrazolo[3,4-b]pyrazine is sourced from PubChem (CID 118012662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).