C13H22F2O4 — CID 118012903
(2R)-3,3-difluoro-2-[(4R,5S)-2,2,5-trimethyl-5-(2-methylprop-1-enyl)-1,3-dioxolan-4-yl]propane-1,2-diol (PubChem CID 118012903) has the molecular formula C13H22F2O4 and a molecular weight of 280.31 g/mol. Its IUPAC name is (2R)-3,3-difluoro-2-[(4R,5S)-2,2,5-trimethyl-5-(2-methylprop-1-enyl)-1,3-dioxolan-4-yl]propane-1,2-diol.
| Compound Name | (2R)-3,3-difluoro-2-[(4R,5S)-2,2,5-trimethyl-5-(2-methylprop-1-enyl)-1,3-dioxolan-4-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 118012903 |
| Molecular Formula | C13H22F2O4 |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | (2R)-3,3-difluoro-2-[(4R,5S)-2,2,5-trimethyl-5-(2-methylprop-1-enyl)-1,3-dioxolan-4-yl]propane-1,2-diol |
| SMILES | CC(C)=C[C@]1(C)OC(C)(C)O[C@@H]1[C@](O)(CO)C(F)F |
| InChI | InChI=1S/C13H22F2O4/c1-8(2)6-12(5)9(18-11(3,4)19-12)13(17,7-16)10(14)15/h6,9-10,16-17H,7H2,1-5H3/t9-,12-,13+/m0/s1 |
| InChIKey | CZPYMLMFFTZUBV-TVYUQYBPSA-N |
| XLogP | 1.85 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|