C14H24F2O3 — CID 118012904
(2R)-1,1-difluoro-2-[(4R,5S)-2,2,5-trimethyl-5-(2-methylprop-1-enyl)-1,3-dioxolan-4-yl]butan-2-ol (PubChem CID 118012904) has the molecular formula C14H24F2O3 and a molecular weight of 278.34 g/mol. Its IUPAC name is (2R)-1,1-difluoro-2-[(4R,5S)-2,2,5-trimethyl-5-(2-methylprop-1-enyl)-1,3-dioxolan-4-yl]butan-2-ol.
| Compound Name | (2R)-1,1-difluoro-2-[(4R,5S)-2,2,5-trimethyl-5-(2-methylprop-1-enyl)-1,3-dioxolan-4-yl]butan-2-ol |
|---|---|
| PubChem CID | 118012904 |
| Molecular Formula | C14H24F2O3 |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | (2R)-1,1-difluoro-2-[(4R,5S)-2,2,5-trimethyl-5-(2-methylprop-1-enyl)-1,3-dioxolan-4-yl]butan-2-ol |
| SMILES | CC[C@](O)(C(F)F)[C@H]1OC(C)(C)O[C@@]1(C)C=C(C)C |
| InChI | InChI=1S/C14H24F2O3/c1-7-14(17,11(15)16)10-13(6,8-9(2)3)19-12(4,5)18-10/h8,10-11,17H,7H2,1-6H3/t10-,13-,14+/m0/s1 |
| InChIKey | ZXFIRFIBQBLZRH-LEWSCRJBSA-N |
| XLogP | 3.27 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|