C20H28F2O5S — CID 118012906
(2R)-1-(benzenesulfonyl)-1,1-difluoro-2-[(4R,5S)-2,2,5-trimethyl-5-(2-methylprop-1-enyl)-1,3-dioxolan-4-yl]butan-2-ol (PubChem CID 118012906) has the molecular formula C20H28F2O5S and a molecular weight of 418.50 g/mol. Its IUPAC name is (2R)-1-(benzenesulfonyl)-1,1-difluoro-2-[(4R,5S)-2,2,5-trimethyl-5-(2-methylprop-1-enyl)-1,3-dioxolan-4-yl]butan-2-ol.
| Compound Name | (2R)-1-(benzenesulfonyl)-1,1-difluoro-2-[(4R,5S)-2,2,5-trimethyl-5-(2-methylprop-1-enyl)-1,3-dioxolan-4-yl]butan-2-ol |
|---|---|
| PubChem CID | 118012906 |
| Molecular Formula | C20H28F2O5S |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | (2R)-1-(benzenesulfonyl)-1,1-difluoro-2-[(4R,5S)-2,2,5-trimethyl-5-(2-methylprop-1-enyl)-1,3-dioxolan-4-yl]butan-2-ol |
| SMILES | CC[C@@](O)([C@H]1OC(C)(C)O[C@@]1(C)C=C(C)C)C(F)(F)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H28F2O5S/c1-7-19(23,16-18(6,13-14(2)3)27-17(4,5)26-16)20(21,22)28(24,25)15-11-9-8-10-12-15/h8-13,16,23H,7H2,1-6H3/t16-,18-,19+/m0/s1 |
| InChIKey | VHQAPQWFABGZTF-YTQUADARSA-N |
| XLogP | 4.07 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|