C15H14F4N4 — CID 118013195
2-[3-(4-fluorophenyl)piperazin-1-yl]-5-(trifluoromethyl)pyrazine (PubChem CID 118013195) has the molecular formula C15H14F4N4 and a molecular weight of 326.30 g/mol. Its IUPAC name is 2-[3-(4-fluorophenyl)piperazin-1-yl]-5-(trifluoromethyl)pyrazine.
| Compound Name | 2-[3-(4-fluorophenyl)piperazin-1-yl]-5-(trifluoromethyl)pyrazine |
|---|---|
| PubChem CID | 118013195 |
| Molecular Formula | C15H14F4N4 |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 2-[3-(4-fluorophenyl)piperazin-1-yl]-5-(trifluoromethyl)pyrazine |
| SMILES | Fc1ccc(C2CN(c3cnc(C(F)(F)F)cn3)CCN2)cc1 |
| InChI | InChI=1S/C15H14F4N4/c16-11-3-1-10(2-4-11)12-9-23(6-5-20-12)14-8-21-13(7-22-14)15(17,18)19/h1-4,7-8,12,20H,5-6,9H2 |
| InChIKey | BQCFWGVGDTYUOJ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |