C9H21N2O7P — CID 118013433
(5-acetamido-6-amino-1,2,4-trihydroxyhexan-3-yl)oxy-methylphosphinic acid (PubChem CID 118013433) has the molecular formula C9H21N2O7P and a molecular weight of 300.25 g/mol. Its IUPAC name is (5-acetamido-6-amino-1,2,4-trihydroxyhexan-3-yl)oxy-methylphosphinic acid.
| Compound Name | (5-acetamido-6-amino-1,2,4-trihydroxyhexan-3-yl)oxy-methylphosphinic acid |
|---|---|
| PubChem CID | 118013433 |
| Molecular Formula | C9H21N2O7P |
| Molecular Weight | 300.25 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | (5-acetamido-6-amino-1,2,4-trihydroxyhexan-3-yl)oxy-methylphosphinic acid |
| SMILES | CC(=O)NC(CN)C(O)C(OP(C)(=O)O)C(O)CO |
| InChI | InChI=1S/C9H21N2O7P/c1-5(13)11-6(3-10)8(15)9(7(14)4-12)18-19(2,16)17/h6-9,12,14-15H,3-4,10H2,1-2H3,(H,11,13)(H,16,17) |
| InChIKey | SAOGMSGBKIBPQH-UHFFFAOYSA-N |
| XLogP | -2.64 |
| TPSA | 162.34 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.25 |
| LogP ≤ 5 | -2.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|