C43H35F3N2O4 — CID 118013491
3-[4-[4-[2-[4-[4-(2,4-dihydro-1,3-benzoxazin-3-yl)phenoxy]phenyl]-1,1,1-trifluoropropan-2-yl]phenoxy]phenyl]-2,4-dihydro-1,3-benzoxazine (PubChem CID 118013491) has the molecular formula C43H35F3N2O4 and a molecular weight of 700.76 g/mol. Its IUPAC name is 3-[4-[4-[2-[4-[4-(2,4-dihydro-1,3-benzoxazin-3-yl)phenoxy]phenyl]-1,1,1-trifluoropropan-2-yl]phenoxy]phenyl]-2,4-dihydro-1,3-benzoxazine.
| Compound Name | 3-[4-[4-[2-[4-[4-(2,4-dihydro-1,3-benzoxazin-3-yl)phenoxy]phenyl]-1,1,1-trifluoropropan-2-yl]phenoxy]phenyl]-2,4-dihydro-1,3-benzoxazine |
|---|---|
| PubChem CID | 118013491 |
| Molecular Formula | C43H35F3N2O4 |
| Molecular Weight | 700.76 g/mol |
| Exact Mass | 700.25 |
| IUPAC Name | 3-[4-[4-[2-[4-[4-(2,4-dihydro-1,3-benzoxazin-3-yl)phenoxy]phenyl]-1,1,1-trifluoropropan-2-yl]phenoxy]phenyl]-2,4-dihydro-1,3-benzoxazine |
| SMILES | CC(c1ccc(Oc2ccc(N3COc4ccccc4C3)cc2)cc1)(c1ccc(Oc2ccc(N3COc4ccccc4C3)cc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C43H35F3N2O4/c1-42(43(44,45)46,32-10-18-36(19-11-32)51-38-22-14-34(15-23-38)47-26-30-6-2-4-8-40(30)49-28-47)33-12-20-37(21-13-33)52-39-24-16-35(17-25-39)48-27-31-7-3-5-9-41(31)50-29-48/h2-25H,26-29H2,1H3 |
| InChIKey | YDUGRSSGSBLBIK-UHFFFAOYSA-N |
| XLogP | 10.85 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.76 |
| LogP ≤ 5 | 10.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |