C33H32N4O6 — CID 11801355
methyl (2S)-2-[[(2R,5R,11bS)-3-oxo-2-(phenylmethoxycarbonylamino)-1,2,5,6,11,11b-hexahydroindolizino[8,7-b]indole-5-carbonyl]amino]-3-phenylpropanoate (PubChem CID 11801355) has the molecular formula C33H32N4O6 and a molecular weight of 580.64 g/mol. Its IUPAC name is methyl (2S)-2-[[(2R,5R,11bS)-3-oxo-2-(phenylmethoxycarbonylamino)-1,2,5,6,11,11b-hexahydroindolizino[8,7-b]indole-5-carbonyl]amino]-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[[(2R,5R,11bS)-3-oxo-2-(phenylmethoxycarbonylamino)-1,2,5,6,11,11b-hexahydroindolizino[8,7-b]indole-5-carbonyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 11801355 |
| Molecular Formula | C33H32N4O6 |
| Molecular Weight | 580.64 g/mol |
| Exact Mass | 580.23 |
| IUPAC Name | methyl (2S)-2-[[(2R,5R,11bS)-3-oxo-2-(phenylmethoxycarbonylamino)-1,2,5,6,11,11b-hexahydroindolizino[8,7-b]indole-5-carbonyl]amino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H]1Cc2c([nH]c3ccccc23)[C@@H]2C[C@@H](NC(=O)OCc3ccccc3)C(=O)N12 |
| InChI | InChI=1S/C33H32N4O6/c1-42-32(40)26(16-20-10-4-2-5-11-20)35-30(38)28-17-23-22-14-8-9-15-24(22)34-29(23)27-18-25(31(39)37(27)28)36-33(41)43-19-21-12-6-3-7-13-21/h2-15,25-28,34H,16-19H2,1H3,(H,35,38)(H,36,41)/t25-,26+,27+,28-/m1/s1 |
| InChIKey | CZJDJQPIKKCDGV-WXIAYYLYSA-N |
| XLogP | 3.56 |
| TPSA | 129.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.64 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|