C40H46O6 — CID 118013692
2-[[4-[2,2-bis(4-butoxyphenyl)-1-[4-(oxiran-2-ylmethoxy)phenyl]ethyl]phenoxy]methyl]oxirane (PubChem CID 118013692) has the molecular formula C40H46O6 and a molecular weight of 622.80 g/mol. Its IUPAC name is 2-[[4-[2,2-bis(4-butoxyphenyl)-1-[4-(oxiran-2-ylmethoxy)phenyl]ethyl]phenoxy]methyl]oxirane.
| Compound Name | 2-[[4-[2,2-bis(4-butoxyphenyl)-1-[4-(oxiran-2-ylmethoxy)phenyl]ethyl]phenoxy]methyl]oxirane |
|---|---|
| PubChem CID | 118013692 |
| Molecular Formula | C40H46O6 |
| Molecular Weight | 622.80 g/mol |
| Exact Mass | 622.33 |
| IUPAC Name | 2-[[4-[2,2-bis(4-butoxyphenyl)-1-[4-(oxiran-2-ylmethoxy)phenyl]ethyl]phenoxy]methyl]oxirane |
| SMILES | CCCCOc1ccc(C(c2ccc(OCCCC)cc2)C(c2ccc(OCC3CO3)cc2)c2ccc(OCC3CO3)cc2)cc1 |
| InChI | InChI=1S/C40H46O6/c1-3-5-23-41-33-15-7-29(8-16-33)39(30-9-17-34(18-10-30)42-24-6-4-2)40(31-11-19-35(20-12-31)43-25-37-27-45-37)32-13-21-36(22-14-32)44-26-38-28-46-38/h7-22,37-40H,3-6,23-28H2,1-2H3 |
| InChIKey | ZKCLXKOQGQDSDF-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 61.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.80 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|