About N-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridin-2-amine
N-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridin-2-amine (PubChem CID 118014619) has the molecular formula C13H11Cl2FN2O
and a molecular weight of 301.15 g/mol. Its IUPAC name is N-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridin-2-amine.
Molecular Properties
| Compound Name | N-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridin-2-amine |
| PubChem CID | 118014619 |
| Molecular Formula | C13H11Cl2FN2O |
| Molecular Weight | 301.15 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | N-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridin-2-amine |
| SMILES | C[C@@H](ONc1ccccn1)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C13H11Cl2FN2O/c1-8(19-18-11-4-2-3-7-17-11)12-9(14)5-6-10(16)13(12)15/h2-8H,1H3,(H,17,18)/t8-/m1/s1 |
| InChIKey | VKQZCVKOTVHJDL-MRVPVSSYSA-N |
| XLogP | 4.63 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.15 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridin-2-amine?
The IUPAC name of N-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridin-2-amine (CID 118014619) is N-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridin-2-amine.
What is the SMILES notation for N-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridin-2-amine?
The canonical SMILES for N-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridin-2-amine is C[C@@H](ONc1ccccn1)c1c(Cl)ccc(F)c1Cl.
What is the InChIKey of N-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridin-2-amine?
The InChIKey is VKQZCVKOTVHJDL-MRVPVSSYSA-N. The full InChI is InChI=1S/C13H11Cl2FN2O/c1-8(19-18-11-4-2-3-7-17-11)12-9(14)5-6-10(16)13(12)15/h2-8H,1H3,(H,17,18)/t8-/m1/s1.
What are the key properties of N-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridin-2-amine?
N-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridin-2-amine has a molecular weight of 301.15 g/mol, XLogP of 4.63, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridin-2-amine is sourced from PubChem (CID 118014619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).