About 3-(difluoromethoxy)-1,5-dimethylpyrazole
3-(difluoromethoxy)-1,5-dimethylpyrazole (PubChem CID 118014942) has the molecular formula C6H8F2N2O
and a molecular weight of 162.14 g/mol. Its IUPAC name is 3-(difluoromethoxy)-1,5-dimethylpyrazole.
Molecular Properties
| Compound Name | 3-(difluoromethoxy)-1,5-dimethylpyrazole |
| PubChem CID | 118014942 |
| Molecular Formula | C6H8F2N2O |
| Molecular Weight | 162.14 g/mol |
| Exact Mass | 162.06 |
| IUPAC Name | 3-(difluoromethoxy)-1,5-dimethylpyrazole |
| SMILES | Cc1cc(OC(F)F)nn1C |
| InChI | InChI=1S/C6H8F2N2O/c1-4-3-5(9-10(4)2)11-6(7)8/h3,6H,1-2H3 |
| InChIKey | NBMQSNKMDDMCCT-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.14 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(difluoromethoxy)-1,5-dimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(difluoromethoxy)-1,5-dimethylpyrazole?
The IUPAC name of 3-(difluoromethoxy)-1,5-dimethylpyrazole (CID 118014942) is 3-(difluoromethoxy)-1,5-dimethylpyrazole.
What is the SMILES notation for 3-(difluoromethoxy)-1,5-dimethylpyrazole?
The canonical SMILES for 3-(difluoromethoxy)-1,5-dimethylpyrazole is Cc1cc(OC(F)F)nn1C.
What is the InChIKey of 3-(difluoromethoxy)-1,5-dimethylpyrazole?
The InChIKey is NBMQSNKMDDMCCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8F2N2O/c1-4-3-5(9-10(4)2)11-6(7)8/h3,6H,1-2H3.
What are the key properties of 3-(difluoromethoxy)-1,5-dimethylpyrazole?
3-(difluoromethoxy)-1,5-dimethylpyrazole has a molecular weight of 162.14 g/mol, XLogP of 1.33, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(difluoromethoxy)-1,5-dimethylpyrazole is sourced from PubChem (CID 118014942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).