C29H52O3 — CID 118014955
2-(1-hydroxyethyl)-3,4a,5,5a,6,9,10,12,12a-nonamethyl-2,3,4,5,6,6a,7,8,9,10,10a,11,11a,12-tetradecahydro-1H-tetracene-1,11-diol (PubChem CID 118014955) has the molecular formula C29H52O3 and a molecular weight of 448.73 g/mol. Its IUPAC name is 2-(1-hydroxyethyl)-3,4a,5,5a,6,9,10,12,12a-nonamethyl-2,3,4,5,6,6a,7,8,9,10,10a,11,11a,12-tetradecahydro-1H-tetracene-1,11-diol.
| Compound Name | 2-(1-hydroxyethyl)-3,4a,5,5a,6,9,10,12,12a-nonamethyl-2,3,4,5,6,6a,7,8,9,10,10a,11,11a,12-tetradecahydro-1H-tetracene-1,11-diol |
|---|---|
| PubChem CID | 118014955 |
| Molecular Formula | C29H52O3 |
| Molecular Weight | 448.73 g/mol |
| Exact Mass | 448.39 |
| IUPAC Name | 2-(1-hydroxyethyl)-3,4a,5,5a,6,9,10,12,12a-nonamethyl-2,3,4,5,6,6a,7,8,9,10,10a,11,11a,12-tetradecahydro-1H-tetracene-1,11-diol |
| SMILES | CC(O)C1C(C)CC2(C)C(C)C3(C)C(C)C4CCC(C)C(C)C4C(O)C3C(C)C2(C)C1O |
| InChI | InChI=1S/C29H52O3/c1-14-11-12-21-17(4)28(9)20(7)27(8)13-15(2)22(19(6)30)26(32)29(27,10)18(5)24(28)25(31)23(21)16(14)3/h14-26,30-32H,11-13H2,1-10H3 |
| InChIKey | IBMQYNNGPPDXON-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.73 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |