C34H52O5 — CID 118015015
2-acetyl-6-(2-cyclopentylethyl)-5-(hydroxymethoxy)-3,4a,5a,10,12,12a-hexamethyl-3,4,5,6,6a,7,10,10a,11a,12-decahydro-2H-tetracene-1,11-dione (PubChem CID 118015015) has the molecular formula C34H52O5 and a molecular weight of 540.79 g/mol. Its IUPAC name is 2-acetyl-6-(2-cyclopentylethyl)-5-(hydroxymethoxy)-3,4a,5a,10,12,12a-hexamethyl-3,4,5,6,6a,7,10,10a,11a,12-decahydro-2H-tetracene-1,11-dione.
| Compound Name | 2-acetyl-6-(2-cyclopentylethyl)-5-(hydroxymethoxy)-3,4a,5a,10,12,12a-hexamethyl-3,4,5,6,6a,7,10,10a,11a,12-decahydro-2H-tetracene-1,11-dione |
|---|---|
| PubChem CID | 118015015 |
| Molecular Formula | C34H52O5 |
| Molecular Weight | 540.79 g/mol |
| Exact Mass | 540.38 |
| IUPAC Name | 2-acetyl-6-(2-cyclopentylethyl)-5-(hydroxymethoxy)-3,4a,5a,10,12,12a-hexamethyl-3,4,5,6,6a,7,10,10a,11a,12-decahydro-2H-tetracene-1,11-dione |
| SMILES | CC(=O)C1C(=O)C2(C)C(C)C3C(=O)C4C(C)C=CCC4C(CCC4CCCC4)C3(C)C(OCO)C2(C)CC1C |
| InChI | InChI=1S/C34H52O5/c1-19-11-10-14-24-25(16-15-23-12-8-9-13-23)33(6)28(29(37)27(19)24)21(3)34(7)30(38)26(22(4)36)20(2)17-32(34,5)31(33)39-18-35/h10-11,19-21,23-28,31,35H,8-9,12-18H2,1-7H3 |
| InChIKey | IHSHBKDADHYNFP-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.79 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|