C32H40O6 — CID 118015065
ethyl 3-(9-acetyl-1-hydroxy-5,5a,6,6a,8,10a,11-heptamethyl-10,12-dioxo-6,7-dihydro-5H-tetracen-2-yl)propanoate (PubChem CID 118015065) has the molecular formula C32H40O6 and a molecular weight of 520.67 g/mol. Its IUPAC name is ethyl 3-(9-acetyl-1-hydroxy-5,5a,6,6a,8,10a,11-heptamethyl-10,12-dioxo-6,7-dihydro-5H-tetracen-2-yl)propanoate.
| Compound Name | ethyl 3-(9-acetyl-1-hydroxy-5,5a,6,6a,8,10a,11-heptamethyl-10,12-dioxo-6,7-dihydro-5H-tetracen-2-yl)propanoate |
|---|---|
| PubChem CID | 118015065 |
| Molecular Formula | C32H40O6 |
| Molecular Weight | 520.67 g/mol |
| Exact Mass | 520.28 |
| IUPAC Name | ethyl 3-(9-acetyl-1-hydroxy-5,5a,6,6a,8,10a,11-heptamethyl-10,12-dioxo-6,7-dihydro-5H-tetracen-2-yl)propanoate |
| SMILES | CCOC(=O)CCc1ccc2c(c1O)C(=O)C1=C(C)C3(C)C(=O)C(C(C)=O)=C(C)CC3(C)C(C)C1(C)C2C |
| InChI | InChI=1S/C32H40O6/c1-10-38-23(34)14-12-21-11-13-22-17(3)31(8)20(6)30(7)15-16(2)24(19(5)33)29(37)32(30,9)18(4)26(31)28(36)25(22)27(21)35/h11,13,17,20,35H,10,12,14-15H2,1-9H3 |
| InChIKey | AGSBMAUPVNNSHV-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.67 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|