C32H34O6 — CID 118015107
(6E)-2-acetyl-10,11,12a-trihydroxy-3,4a,5,5a-tetramethyl-6-[(4-methylphenyl)methylidene]-2,3,4,5-tetrahydrotetracene-1,12-dione (PubChem CID 118015107) has the molecular formula C32H34O6 and a molecular weight of 514.62 g/mol. Its IUPAC name is (6E)-2-acetyl-10,11,12a-trihydroxy-3,4a,5,5a-tetramethyl-6-[(4-methylphenyl)methylidene]-2,3,4,5-tetrahydrotetracene-1,12-dione.
| Compound Name | (6E)-2-acetyl-10,11,12a-trihydroxy-3,4a,5,5a-tetramethyl-6-[(4-methylphenyl)methylidene]-2,3,4,5-tetrahydrotetracene-1,12-dione |
|---|---|
| PubChem CID | 118015107 |
| Molecular Formula | C32H34O6 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | (6E)-2-acetyl-10,11,12a-trihydroxy-3,4a,5,5a-tetramethyl-6-[(4-methylphenyl)methylidene]-2,3,4,5-tetrahydrotetracene-1,12-dione |
| SMILES | CC(=O)C1C(=O)C2(O)C(=O)C3=C(O)c4c(O)cccc4/C(=C\c4ccc(C)cc4)C3(C)C(C)C2(C)CC1C |
| InChI | InChI=1S/C32H34O6/c1-16-10-12-20(13-11-16)14-22-21-8-7-9-23(34)25(21)27(35)26-29(37)32(38)28(36)24(18(3)33)17(2)15-30(32,5)19(4)31(22,26)6/h7-14,17,19,24,34-35,38H,15H2,1-6H3/b22-14+ |
| InChIKey | KAXMEHSZNUEBKU-HYARGMPZSA-N |
| XLogP | 5.30 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|