C35H46O5 — CID 118015120
tert-butyl 2-(9-acetyl-1,5a,6a,8,10a,11-hexamethyl-10,12-dioxo-4-propan-2-yl-6,7-dihydro-5H-tetracen-2-yl)acetate (PubChem CID 118015120) has the molecular formula C35H46O5 and a molecular weight of 546.75 g/mol. Its IUPAC name is tert-butyl 2-(9-acetyl-1,5a,6a,8,10a,11-hexamethyl-10,12-dioxo-4-propan-2-yl-6,7-dihydro-5H-tetracen-2-yl)acetate.
| Compound Name | tert-butyl 2-(9-acetyl-1,5a,6a,8,10a,11-hexamethyl-10,12-dioxo-4-propan-2-yl-6,7-dihydro-5H-tetracen-2-yl)acetate |
|---|---|
| PubChem CID | 118015120 |
| Molecular Formula | C35H46O5 |
| Molecular Weight | 546.75 g/mol |
| Exact Mass | 546.33 |
| IUPAC Name | tert-butyl 2-(9-acetyl-1,5a,6a,8,10a,11-hexamethyl-10,12-dioxo-4-propan-2-yl-6,7-dihydro-5H-tetracen-2-yl)acetate |
| SMILES | CC(=O)C1=C(C)CC2(C)CC3(C)Cc4c(C(C)C)cc(CC(=O)OC(C)(C)C)c(C)c4C(=O)C3=C(C)C2(C)C1=O |
| InChI | InChI=1S/C35H46O5/c1-18(2)24-13-23(14-26(37)40-32(7,8)9)20(4)28-25(24)16-33(10)17-34(11)15-19(3)27(22(6)36)31(39)35(34,12)21(5)29(33)30(28)38/h13,18H,14-17H2,1-12H3 |
| InChIKey | ZDXTVHSKKNDYAN-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.75 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|