C34H50O4 — CID 118015230
7-(5-acetylcyclohex-2-en-1-yl)-2-(1-hydroxyethyl)-3,4a,5a,10,12,12a-hexamethyl-5,6,6a,7,8,9,10,10a,11a,12-decahydro-4H-tetracene-1,11-dione (PubChem CID 118015230) has the molecular formula C34H50O4 and a molecular weight of 522.77 g/mol. Its IUPAC name is 7-(5-acetylcyclohex-2-en-1-yl)-2-(1-hydroxyethyl)-3,4a,5a,10,12,12a-hexamethyl-5,6,6a,7,8,9,10,10a,11a,12-decahydro-4H-tetracene-1,11-dione.
| Compound Name | 7-(5-acetylcyclohex-2-en-1-yl)-2-(1-hydroxyethyl)-3,4a,5a,10,12,12a-hexamethyl-5,6,6a,7,8,9,10,10a,11a,12-decahydro-4H-tetracene-1,11-dione |
|---|---|
| PubChem CID | 118015230 |
| Molecular Formula | C34H50O4 |
| Molecular Weight | 522.77 g/mol |
| Exact Mass | 522.37 |
| IUPAC Name | 7-(5-acetylcyclohex-2-en-1-yl)-2-(1-hydroxyethyl)-3,4a,5a,10,12,12a-hexamethyl-5,6,6a,7,8,9,10,10a,11a,12-decahydro-4H-tetracene-1,11-dione |
| SMILES | CC(=O)C1CC=CC(C2CCC(C)C3C(=O)C4C(C)C5(C)C(=O)C(C(C)O)=C(C)CC5(C)CC4(C)CC23)C1 |
| InChI | InChI=1S/C34H50O4/c1-18-12-13-25(24-11-9-10-23(14-24)21(4)35)26-16-32(6)17-33(7)15-19(2)27(22(5)36)31(38)34(33,8)20(3)29(32)30(37)28(18)26/h9,11,18,20,22-26,28-29,36H,10,12-17H2,1-8H3 |
| InChIKey | TVCKHXJXJQGCRC-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.77 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|