C27H45NO8 — CID 118015323
(4aS,5aS,12aS)-2-acetyl-7-(dimethylamino)-3,10,11,12,12a-pentahydroxy-9-(2-hydroxypentyl)-2,3,4,4a,5,5a,6,6a,7,8,9,10,10a,11,11a,12-hexadecahydrotetracen-1-one (PubChem CID 118015323) has the molecular formula C27H45NO8 and a molecular weight of 511.66 g/mol. Its IUPAC name is (4aS,5aS,12aS)-2-acetyl-7-(dimethylamino)-3,10,11,12,12a-pentahydroxy-9-(2-hydroxypentyl)-2,3,4,4a,5,5a,6,6a,7,8,9,10,10a,11,11a,12-hexadecahydrotetracen-1-one.
| Compound Name | (4aS,5aS,12aS)-2-acetyl-7-(dimethylamino)-3,10,11,12,12a-pentahydroxy-9-(2-hydroxypentyl)-2,3,4,4a,5,5a,6,6a,7,8,9,10,10a,11,11a,12-hexadecahydrotetracen-1-one |
|---|---|
| PubChem CID | 118015323 |
| Molecular Formula | C27H45NO8 |
| Molecular Weight | 511.66 g/mol |
| Exact Mass | 511.31 |
| IUPAC Name | (4aS,5aS,12aS)-2-acetyl-7-(dimethylamino)-3,10,11,12,12a-pentahydroxy-9-(2-hydroxypentyl)-2,3,4,4a,5,5a,6,6a,7,8,9,10,10a,11,11a,12-hexadecahydrotetracen-1-one |
| SMILES | CCCC(O)CC1CC(N(C)C)C2C[C@H]3C[C@H]4CC(O)C(C(C)=O)C(=O)[C@@]4(O)C(O)C3C(O)C2C1O |
| InChI | InChI=1S/C27H45NO8/c1-5-6-16(30)8-14-10-18(28(3)4)17-9-13-7-15-11-19(31)20(12(2)29)25(34)27(15,36)26(35)21(13)24(33)22(17)23(14)32/h13-24,26,30-33,35-36H,5-11H2,1-4H3/t13-,14?,15+,16?,17?,18?,19?,20?,21?,22?,23?,24?,26?,27-/m1/s1 |
| InChIKey | GXKFKXCLDSGLEO-LSSIJYQLSA-N |
| XLogP | -0.27 |
| TPSA | 158.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.66 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|