C27H32O5 — CID 118015526
8-(1-hydroxyethyl)-4,6,6a,9,10a,11a-hexamethyl-5,7-dioxo-11,12-dihydro-10H-tetracene-1-carboxylic acid (PubChem CID 118015526) has the molecular formula C27H32O5 and a molecular weight of 436.55 g/mol. Its IUPAC name is 8-(1-hydroxyethyl)-4,6,6a,9,10a,11a-hexamethyl-5,7-dioxo-11,12-dihydro-10H-tetracene-1-carboxylic acid.
| Compound Name | 8-(1-hydroxyethyl)-4,6,6a,9,10a,11a-hexamethyl-5,7-dioxo-11,12-dihydro-10H-tetracene-1-carboxylic acid |
|---|---|
| PubChem CID | 118015526 |
| Molecular Formula | C27H32O5 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | 8-(1-hydroxyethyl)-4,6,6a,9,10a,11a-hexamethyl-5,7-dioxo-11,12-dihydro-10H-tetracene-1-carboxylic acid |
| SMILES | CC1=C(C(C)O)C(=O)C2(C)C(C)=C3C(=O)c4c(C)ccc(C(=O)O)c4CC3(C)CC2(C)C1 |
| InChI | InChI=1S/C27H32O5/c1-13-8-9-17(24(31)32)18-11-25(5)12-26(6)10-14(2)19(16(4)28)23(30)27(26,7)15(3)21(25)22(29)20(13)18/h8-9,16,28H,10-12H2,1-7H3,(H,31,32) |
| InChIKey | HWTTTXDFVKYWLY-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |