C33H38O6 — CID 118015558
2-acetyl-3,4a,5a,10,12,12a-hexamethyl-7-[2-(oxan-4-yl)-2-oxoacetyl]-5,6-dihydro-4H-tetracene-1,11-dione (PubChem CID 118015558) has the molecular formula C33H38O6 and a molecular weight of 530.66 g/mol. Its IUPAC name is 2-acetyl-3,4a,5a,10,12,12a-hexamethyl-7-[2-(oxan-4-yl)-2-oxoacetyl]-5,6-dihydro-4H-tetracene-1,11-dione.
| Compound Name | 2-acetyl-3,4a,5a,10,12,12a-hexamethyl-7-[2-(oxan-4-yl)-2-oxoacetyl]-5,6-dihydro-4H-tetracene-1,11-dione |
|---|---|
| PubChem CID | 118015558 |
| Molecular Formula | C33H38O6 |
| Molecular Weight | 530.66 g/mol |
| Exact Mass | 530.27 |
| IUPAC Name | 2-acetyl-3,4a,5a,10,12,12a-hexamethyl-7-[2-(oxan-4-yl)-2-oxoacetyl]-5,6-dihydro-4H-tetracene-1,11-dione |
| SMILES | CC(=O)C1=C(C)CC2(C)CC3(C)Cc4c(C(=O)C(=O)C5CCOCC5)ccc(C)c4C(=O)C3=C(C)C2(C)C1=O |
| InChI | InChI=1S/C33H38O6/c1-17-8-9-22(28(36)27(35)21-10-12-39-13-11-21)23-15-31(5)16-32(6)14-18(2)24(20(4)34)30(38)33(32,7)19(3)26(31)29(37)25(17)23/h8-9,21H,10-16H2,1-7H3 |
| InChIKey | YWOZBFBPMHUQJQ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.66 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|