C33H36O3 — CID 118015716
(4aR,5aR,12aR)-2-acetyl-3,4a,5a,10,12,12a-hexamethyl-7-(2-methylphenyl)-5,6-dihydro-4H-tetracene-1,11-dione (PubChem CID 118015716) has the molecular formula C33H36O3 and a molecular weight of 480.65 g/mol. Its IUPAC name is (4aR,5aR,12aR)-2-acetyl-3,4a,5a,10,12,12a-hexamethyl-7-(2-methylphenyl)-5,6-dihydro-4H-tetracene-1,11-dione.
| Compound Name | (4aR,5aR,12aR)-2-acetyl-3,4a,5a,10,12,12a-hexamethyl-7-(2-methylphenyl)-5,6-dihydro-4H-tetracene-1,11-dione |
|---|---|
| PubChem CID | 118015716 |
| Molecular Formula | C33H36O3 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | (4aR,5aR,12aR)-2-acetyl-3,4a,5a,10,12,12a-hexamethyl-7-(2-methylphenyl)-5,6-dihydro-4H-tetracene-1,11-dione |
| SMILES | CC(=O)C1=C(C)C[C@]2(C)C[C@]3(C)Cc4c(-c5ccccc5C)ccc(C)c4C(=O)C3=C(C)[C@]2(C)C1=O |
| InChI | InChI=1S/C33H36O3/c1-18-11-9-10-12-23(18)24-14-13-19(2)27-25(24)16-31(6)17-32(7)15-20(3)26(22(5)34)30(36)33(32,8)21(4)28(31)29(27)35/h9-14H,15-17H2,1-8H3/t31-,32+,33+/m0/s1 |
| InChIKey | OJFGNVLYGKCNLX-WIHCDAFUSA-N |
| XLogP | 7.33 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|