C31H40O3 — CID 118015819
2-acetyl-9-ethyl-3,4a,5a,10,12,12a-hexamethyl-7-propyl-5,6-dihydro-4H-tetracene-1,11-dione (PubChem CID 118015819) has the molecular formula C31H40O3 and a molecular weight of 460.66 g/mol. Its IUPAC name is 2-acetyl-9-ethyl-3,4a,5a,10,12,12a-hexamethyl-7-propyl-5,6-dihydro-4H-tetracene-1,11-dione.
| Compound Name | 2-acetyl-9-ethyl-3,4a,5a,10,12,12a-hexamethyl-7-propyl-5,6-dihydro-4H-tetracene-1,11-dione |
|---|---|
| PubChem CID | 118015819 |
| Molecular Formula | C31H40O3 |
| Molecular Weight | 460.66 g/mol |
| Exact Mass | 460.30 |
| IUPAC Name | 2-acetyl-9-ethyl-3,4a,5a,10,12,12a-hexamethyl-7-propyl-5,6-dihydro-4H-tetracene-1,11-dione |
| SMILES | CCCc1cc(CC)c(C)c2c1CC1(C)CC3(C)CC(C)=C(C(C)=O)C(=O)C3(C)C(C)=C1C2=O |
| InChI | InChI=1S/C31H40O3/c1-10-12-22-13-21(11-2)18(4)25-23(22)15-29(7)16-30(8)14-17(3)24(20(6)32)28(34)31(30,9)19(5)26(29)27(25)33/h13H,10-12,14-16H2,1-9H3 |
| InChIKey | KNVDMVUPEUSYKE-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.66 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|