C31H50O3 — CID 118015829
1-cyclopentyl-7-hydroxy-8-(1-hydroxyethyl)-4,6,6a,9,10a,11a-hexamethyl-1,2,3,4,4a,5a,6,7,10,11,12,12a-dodecahydrotetracen-5-one (PubChem CID 118015829) has the molecular formula C31H50O3 and a molecular weight of 470.74 g/mol. Its IUPAC name is 1-cyclopentyl-7-hydroxy-8-(1-hydroxyethyl)-4,6,6a,9,10a,11a-hexamethyl-1,2,3,4,4a,5a,6,7,10,11,12,12a-dodecahydrotetracen-5-one.
| Compound Name | 1-cyclopentyl-7-hydroxy-8-(1-hydroxyethyl)-4,6,6a,9,10a,11a-hexamethyl-1,2,3,4,4a,5a,6,7,10,11,12,12a-dodecahydrotetracen-5-one |
|---|---|
| PubChem CID | 118015829 |
| Molecular Formula | C31H50O3 |
| Molecular Weight | 470.74 g/mol |
| Exact Mass | 470.38 |
| IUPAC Name | 1-cyclopentyl-7-hydroxy-8-(1-hydroxyethyl)-4,6,6a,9,10a,11a-hexamethyl-1,2,3,4,4a,5a,6,7,10,11,12,12a-dodecahydrotetracen-5-one |
| SMILES | CC1=C(C(C)O)C(O)C2(C)C(C)C3C(=O)C4C(C)CCC(C5CCCC5)C4CC3(C)CC2(C)C1 |
| InChI | InChI=1S/C31H50O3/c1-17-12-13-22(21-10-8-9-11-21)23-15-29(5)16-30(6)14-18(2)24(20(4)32)28(34)31(30,7)19(3)26(29)27(33)25(17)23/h17,19-23,25-26,28,32,34H,8-16H2,1-7H3 |
| InChIKey | MATYLYLGQKUZKD-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.74 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|