C41H68O5 — CID 118015833
3-[(1,3-dihydroxy-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-yl)methyl]-7-hydroxy-8-(1-hydroxyethyl)-4,6,6a,9,10a,11a-hexamethyl-1-pentyl-1,4,4a,5a,6,7,8,9,10,11,12,12a-dodecahydrotetracen-5-one (PubChem CID 118015833) has the molecular formula C41H68O5 and a molecular weight of 640.99 g/mol. Its IUPAC name is 3-[(1,3-dihydroxy-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-yl)methyl]-7-hydroxy-8-(1-hydroxyethyl)-4,6,6a,9,10a,11a-hexamethyl-1-pentyl-1,4,4a,5a,6,7,8,9,10,11,12,12a-dodecahydrotetracen-5-one.
| Compound Name | 3-[(1,3-dihydroxy-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-yl)methyl]-7-hydroxy-8-(1-hydroxyethyl)-4,6,6a,9,10a,11a-hexamethyl-1-pentyl-1,4,4a,5a,6,7,8,9,10,11,12,12a-dodecahydrotetracen-5-one |
|---|---|
| PubChem CID | 118015833 |
| Molecular Formula | C41H68O5 |
| Molecular Weight | 640.99 g/mol |
| Exact Mass | 640.51 |
| IUPAC Name | 3-[(1,3-dihydroxy-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-yl)methyl]-7-hydroxy-8-(1-hydroxyethyl)-4,6,6a,9,10a,11a-hexamethyl-1-pentyl-1,4,4a,5a,6,7,8,9,10,11,12,12a-dodecahydrotetracen-5-one |
| SMILES | CCCCCC1C=C(CC2C(O)C3CCCCC3C2O)C(C)C2C(=O)C3C(C)C4(C)C(O)C(C(C)O)C(C)CC4(C)CC3(C)CC12 |
| InChI | InChI=1S/C41H68O5/c1-9-10-11-14-26-17-27(18-30-35(43)28-15-12-13-16-29(28)36(30)44)23(3)33-31(26)20-39(6)21-40(7)19-22(2)32(25(5)42)38(46)41(40,8)24(4)34(39)37(33)45/h17,22-26,28-36,38,42-44,46H,9-16,18-21H2,1-8H3 |
| InChIKey | RLDHZTKMLXRWFR-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.99 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|