C36H40O4 — CID 118015837
2-acetyl-3,4a,5a,10,12,12a-hexamethyl-9-(3-oxobutyl)-7-phenyl-5,6-dihydro-4H-tetracene-1,11-dione (PubChem CID 118015837) has the molecular formula C36H40O4 and a molecular weight of 536.71 g/mol. Its IUPAC name is 2-acetyl-3,4a,5a,10,12,12a-hexamethyl-9-(3-oxobutyl)-7-phenyl-5,6-dihydro-4H-tetracene-1,11-dione.
| Compound Name | 2-acetyl-3,4a,5a,10,12,12a-hexamethyl-9-(3-oxobutyl)-7-phenyl-5,6-dihydro-4H-tetracene-1,11-dione |
|---|---|
| PubChem CID | 118015837 |
| Molecular Formula | C36H40O4 |
| Molecular Weight | 536.71 g/mol |
| Exact Mass | 536.29 |
| IUPAC Name | 2-acetyl-3,4a,5a,10,12,12a-hexamethyl-9-(3-oxobutyl)-7-phenyl-5,6-dihydro-4H-tetracene-1,11-dione |
| SMILES | CC(=O)CCc1cc(-c2ccccc2)c2c(c1C)C(=O)C1=C(C)C3(C)C(=O)C(C(C)=O)=C(C)CC3(C)CC1(C)C2 |
| InChI | InChI=1S/C36H40O4/c1-20-17-35(7)19-34(6)18-28-27(25-12-10-9-11-13-25)16-26(15-14-21(2)37)22(3)30(28)32(39)31(34)23(4)36(35,8)33(40)29(20)24(5)38/h9-13,16H,14-15,17-19H2,1-8H3 |
| InChIKey | DCBYVEBUHQBDMH-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.71 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|